C9H19ClN4O2S — CID 120708509
N-(3-aminobutyl)-2-ethylpyrazole-3-sulfonamide;hydrochloride (PubChem CID 120708509) has the molecular formula C9H19ClN4O2S and a molecular weight of 282.80 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-ethylpyrazole-3-sulfonamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-2-ethylpyrazole-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120708509 |
| Molecular Formula | C9H19ClN4O2S |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(3-aminobutyl)-2-ethylpyrazole-3-sulfonamide;hydrochloride |
| SMILES | CCn1nccc1S(=O)(=O)NCCC(C)N.Cl |
| InChI | InChI=1S/C9H18N4O2S.ClH/c1-3-13-9(5-6-11-13)16(14,15)12-7-4-8(2)10;/h5-6,8,12H,3-4,7,10H2,1-2H3;1H |
| InChIKey | LLVGFAQZJKLMFO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |