C10H20N4O2S — CID 120713883
2-ethyl-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-sulfonamide (PubChem CID 120713883) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-ethyl-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-sulfonamide.
| Compound Name | 2-ethyl-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 120713883 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-ethyl-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-sulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1ccnn1CC |
| InChI | InChI=1S/C10H20N4O2S/c1-4-11-9(3)8-13-17(15,16)10-6-7-12-14(10)5-2/h6-7,9,11,13H,4-5,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | SHPFZYFPCFUVOD-SECBINFHSA-N |
| XLogP | 0.18 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |