C11H22N4O3S — CID 122570703
N-[3-(dimethylamino)-2-hydroxypropyl]-2-propylpyrazole-3-sulfonamide (PubChem CID 122570703) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxypropyl]-2-propylpyrazole-3-sulfonamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxypropyl]-2-propylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 122570703 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxypropyl]-2-propylpyrazole-3-sulfonamide |
| SMILES | CCCn1nccc1S(=O)(=O)NCC(O)CN(C)C |
| InChI | InChI=1S/C11H22N4O3S/c1-4-7-15-11(5-6-12-15)19(17,18)13-8-10(16)9-14(2)3/h5-6,10,13,16H,4,7-9H2,1-3H3 |
| InChIKey | QYPFJZRSWSWJLM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |