C18H25ClN4O2S — CID 120713581
N-[1-(aminomethyl)-2-methylcyclohexyl]-2-phenylpyrimidine-5-sulfonamide;hydrochloride (PubChem CID 120713581) has the molecular formula C18H25ClN4O2S and a molecular weight of 396.94 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2-methylcyclohexyl]-2-phenylpyrimidine-5-sulfonamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-2-phenylpyrimidine-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120713581 |
| Molecular Formula | C18H25ClN4O2S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-2-phenylpyrimidine-5-sulfonamide;hydrochloride |
| SMILES | CC1CCCCC1(CN)NS(=O)(=O)c1cnc(-c2ccccc2)nc1.Cl |
| InChI | InChI=1S/C18H24N4O2S.ClH/c1-14-7-5-6-10-18(14,13-19)22-25(23,24)16-11-20-17(21-12-16)15-8-3-2-4-9-15;/h2-4,8-9,11-12,14,22H,5-7,10,13,19H2,1H3;1H |
| InChIKey | CRGPYBRISJEUMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |