C15H24ClN3O3S — CID 120607408
3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]benzamide;hydrochloride (PubChem CID 120607408) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]benzamide;hydrochloride.
| Compound Name | 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120607408 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-[[1-(aminomethyl)-2-methylcyclohexyl]sulfamoyl]benzamide;hydrochloride |
| SMILES | CC1CCCCC1(CN)NS(=O)(=O)c1cccc(C(N)=O)c1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-11-5-2-3-8-15(11,10-16)18-22(20,21)13-7-4-6-12(9-13)14(17)19;/h4,6-7,9,11,18H,2-3,5,8,10,16H2,1H3,(H2,17,19);1H |
| InChIKey | JYDIZRQHLTYABB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |