C15H24ClN3O4S — CID 120713687
N-(2-amino-1-cyclopentylethyl)-3,6-dimethyl-2-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120713687) has the molecular formula C15H24ClN3O4S and a molecular weight of 377.89 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-3,6-dimethyl-2-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-3,6-dimethyl-2-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120713687 |
| Molecular Formula | C15H24ClN3O4S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-3,6-dimethyl-2-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(CN)C2CCCC2)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H23N3O4S.ClH/c1-10-7-8-11(2)15(14(10)18(19)20)23(21,22)17-13(9-16)12-5-3-4-6-12;/h7-8,12-13,17H,3-6,9,16H2,1-2H3;1H |
| InChIKey | SGLCPXNPYSARMD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|