C14H22N2O4S2 — CID 120715329
N-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine (PubChem CID 120715329) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine.
| Compound Name | N-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 120715329 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine |
| SMILES | CNC1CCCN(S(=O)(=O)c2cc(S(C)(=O)=O)ccc2C)C1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-11-6-7-13(21(3,17)18)9-14(11)22(19,20)16-8-4-5-12(10-16)15-2/h6-7,9,12,15H,4-5,8,10H2,1-3H3 |
| InChIKey | NHYNFMWEGOGMRL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |