C15H23ClN2O3S — CID 120719292
9-(4-ethoxyphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane;hydrochloride (PubChem CID 120719292) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane;hydrochloride.
| Compound Name | 9-(4-ethoxyphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane;hydrochloride |
|---|---|
| PubChem CID | 120719292 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 9-(4-ethoxyphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N2C3CCNCC2CC3)cc1.Cl |
| InChI | InChI=1S/C15H22N2O3S.ClH/c1-2-20-14-5-7-15(8-6-14)21(18,19)17-12-3-4-13(17)11-16-10-9-12;/h5-8,12-13,16H,2-4,9-11H2,1H3;1H |
| InChIKey | XWQWEGWPUZXKPR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |