C14H22N2O3S — CID 63909437
1-(4-ethoxyphenyl)sulfonyl-2,6-dimethylpiperazine (PubChem CID 63909437) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-2,6-dimethylpiperazine.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-2,6-dimethylpiperazine |
|---|---|
| PubChem CID | 63909437 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-2,6-dimethylpiperazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2C(C)CNCC2C)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-4-19-13-5-7-14(8-6-13)20(17,18)16-11(2)9-15-10-12(16)3/h5-8,11-12,15H,4,9-10H2,1-3H3 |
| InChIKey | JIPOVSYKENTXSY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |