C12H25ClN2O3S — CID 120720798
N-[(3-methylpiperidin-3-yl)methyl]-1-(oxolan-3-yl)methanesulfonamide;hydrochloride (PubChem CID 120720798) has the molecular formula C12H25ClN2O3S and a molecular weight of 312.86 g/mol. Its IUPAC name is N-[(3-methylpiperidin-3-yl)methyl]-1-(oxolan-3-yl)methanesulfonamide;hydrochloride.
| Compound Name | N-[(3-methylpiperidin-3-yl)methyl]-1-(oxolan-3-yl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120720798 |
| Molecular Formula | C12H25ClN2O3S |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[(3-methylpiperidin-3-yl)methyl]-1-(oxolan-3-yl)methanesulfonamide;hydrochloride |
| SMILES | CC1(CNS(=O)(=O)CC2CCOC2)CCCNC1.Cl |
| InChI | InChI=1S/C12H24N2O3S.ClH/c1-12(4-2-5-13-9-12)10-14-18(15,16)8-11-3-6-17-7-11;/h11,13-14H,2-10H2,1H3;1H |
| InChIKey | WSTVCOJZSPSMGJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |