C13H27ClN2O2S — CID 120876267
1-cyclopentyl-N-[(3-methylpiperidin-3-yl)methyl]methanesulfonamide;hydrochloride (PubChem CID 120876267) has the molecular formula C13H27ClN2O2S and a molecular weight of 310.89 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(3-methylpiperidin-3-yl)methyl]methanesulfonamide;hydrochloride.
| Compound Name | 1-cyclopentyl-N-[(3-methylpiperidin-3-yl)methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876267 |
| Molecular Formula | C13H27ClN2O2S |
| Molecular Weight | 310.89 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-cyclopentyl-N-[(3-methylpiperidin-3-yl)methyl]methanesulfonamide;hydrochloride |
| SMILES | CC1(CNS(=O)(=O)CC2CCCC2)CCCNC1.Cl |
| InChI | InChI=1S/C13H26N2O2S.ClH/c1-13(7-4-8-14-10-13)11-15-18(16,17)9-12-5-2-3-6-12;/h12,14-15H,2-11H2,1H3;1H |
| InChIKey | RAEHDHZLJSDHRD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.89 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |