C15H29ClN2O4S — CID 120727075
2-[[1-(cyclohexylmethylsulfonyl)piperidin-3-yl]methylamino]acetic acid;hydrochloride (PubChem CID 120727075) has the molecular formula C15H29ClN2O4S and a molecular weight of 368.93 g/mol. Its IUPAC name is 2-[[1-(cyclohexylmethylsulfonyl)piperidin-3-yl]methylamino]acetic acid;hydrochloride.
| Compound Name | 2-[[1-(cyclohexylmethylsulfonyl)piperidin-3-yl]methylamino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 120727075 |
| Molecular Formula | C15H29ClN2O4S |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[[1-(cyclohexylmethylsulfonyl)piperidin-3-yl]methylamino]acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CNCC1CCCN(S(=O)(=O)CC2CCCCC2)C1 |
| InChI | InChI=1S/C15H28N2O4S.ClH/c18-15(19)10-16-9-14-7-4-8-17(11-14)22(20,21)12-13-5-2-1-3-6-13;/h13-14,16H,1-12H2,(H,18,19);1H |
| InChIKey | FTNSHIVCDIGFCV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |