C16H23ClN4O2 — CID 120729616
1-ethyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrolidin-2-one;hydrochloride (PubChem CID 120729616) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 1-ethyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-ethyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120729616 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-ethyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrolidin-2-one;hydrochloride |
| SMILES | CCN1CC(C(=O)N2CCNCC2c2cccnc2)CC1=O.Cl |
| InChI | InChI=1S/C16H22N4O2.ClH/c1-2-19-11-13(8-15(19)21)16(22)20-7-6-18-10-14(20)12-4-3-5-17-9-12;/h3-5,9,13-14,18H,2,6-8,10-11H2,1H3;1H |
| InChIKey | WDBQZNUDSIVRIJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |