C21H26ClN3O3 — CID 120729626
(3,4-dimethoxy-5-prop-2-enylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120729626) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is (3,4-dimethoxy-5-prop-2-enylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120729626 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | C=CCc1cc(C(=O)N2CCNCC2c2cccnc2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C21H25N3O3.ClH/c1-4-6-15-11-17(12-19(26-2)20(15)27-3)21(25)24-10-9-23-14-18(24)16-7-5-8-22-13-16;/h4-5,7-8,11-13,18,23H,1,6,9-10,14H2,2-3H3;1H |
| InChIKey | VEIUHYVSBQZUFK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|