C22H28ClN3O3 — CID 120729126
(4-cyclopentyloxy-3-methoxyphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120729126) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is (4-cyclopentyloxy-3-methoxyphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (4-cyclopentyloxy-3-methoxyphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120729126 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (4-cyclopentyloxy-3-methoxyphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | COc1cc(C(=O)N2CCNCC2c2cccnc2)ccc1OC1CCCC1.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-27-21-13-16(8-9-20(21)28-18-6-2-3-7-18)22(26)25-12-11-24-15-19(25)17-5-4-10-23-14-17;/h4-5,8-10,13-14,18-19,24H,2-3,6-7,11-12,15H2,1H3;1H |
| InChIKey | NQOPRIFRYOGRQU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |