C20H23Cl2N5O — CID 120730841
[4-(imidazol-1-ylmethyl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 120730841) has the molecular formula C20H23Cl2N5O and a molecular weight of 420.34 g/mol. Its IUPAC name is [4-(imidazol-1-ylmethyl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | [4-(imidazol-1-ylmethyl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120730841 |
| Molecular Formula | C20H23Cl2N5O |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [4-(imidazol-1-ylmethyl)phenyl]-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccc(Cn2ccnc2)cc1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C20H21N5O.2ClH/c26-20(17-5-3-16(4-6-17)14-24-10-8-23-15-24)25-11-9-22-13-19(25)18-2-1-7-21-12-18;;/h1-8,10,12,15,19,22H,9,11,13-14H2;2*1H |
| InChIKey | QVBFXWXVIGLOIG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |