C23H30ClN3O2 — CID 120730987
3-(3-cyclopentyloxyphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride (PubChem CID 120730987) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-(3-cyclopentyloxyphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 3-(3-cyclopentyloxyphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120730987 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-(3-cyclopentyloxyphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCc1cccc(OC2CCCC2)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C23H29N3O2.ClH/c27-23(26-14-13-25-17-22(26)19-6-4-12-24-16-19)11-10-18-5-3-9-21(15-18)28-20-7-1-2-8-20;/h3-6,9,12,15-16,20,22,25H,1-2,7-8,10-11,13-14,17H2;1H |
| InChIKey | XZPYYYCKLZPLOQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |