C20H21ClN4O2 — CID 120731988
1-methyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)quinolin-2-one;hydrochloride (PubChem CID 120731988) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 1-methyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)quinolin-2-one;hydrochloride.
| Compound Name | 1-methyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 120731988 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-methyl-4-(2-pyridin-3-ylpiperazine-1-carbonyl)quinolin-2-one;hydrochloride |
| SMILES | Cl.Cn1c(=O)cc(C(=O)N2CCNCC2c2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O2.ClH/c1-23-17-7-3-2-6-15(17)16(11-19(23)25)20(26)24-10-9-22-13-18(24)14-5-4-8-21-12-14;/h2-8,11-12,18,22H,9-10,13H2,1H3;1H |
| InChIKey | VMMZXHOXBABWAX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |