C19H20N4O3 — CID 120732611
2-[2-oxo-2-(2-pyridin-3-ylpiperazin-1-yl)ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 120732611) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[2-oxo-2-(2-pyridin-3-ylpiperazin-1-yl)ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-[2-oxo-2-(2-pyridin-3-ylpiperazin-1-yl)ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 120732611 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[2-oxo-2-(2-pyridin-3-ylpiperazin-1-yl)ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2ccccc2OC1CC(=O)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C19H20N4O3/c24-18(10-17-19(25)22-14-5-1-2-6-16(14)26-17)23-9-8-21-12-15(23)13-4-3-7-20-11-13/h1-7,11,15,17,21H,8-10,12H2,(H,22,25) |
| InChIKey | GNROLKFHRDBHSJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |