C18H21ClN2O2S — CID 120733797
2-(5-chlorothiophen-2-yl)-1-[2-(2-methoxyphenyl)piperazin-1-yl]propan-1-one (PubChem CID 120733797) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-[2-(2-methoxyphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-[2-(2-methoxyphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 120733797 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-[2-(2-methoxyphenyl)piperazin-1-yl]propan-1-one |
| SMILES | COc1ccccc1C1CNCCN1C(=O)C(C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-12(16-7-8-17(19)24-16)18(22)21-10-9-20-11-14(21)13-5-3-4-6-15(13)23-2/h3-8,12,14,20H,9-11H2,1-2H3 |
| InChIKey | IBCNZLRDAHTORL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |