C36H52N2O2 — CID 12073390
2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 12073390) has the molecular formula C36H52N2O2 and a molecular weight of 544.82 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 12073390 |
| Molecular Formula | C36H52N2O2 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H52N2O2/c1-33(2,3)26-17-24(31(39)29(19-26)35(7,8)9)21-38(23-28-15-13-14-16-37-28)22-25-18-27(34(4,5)6)20-30(32(25)40)36(10,11)12/h13-20,39-40H,21-23H2,1-12H3 |
| InChIKey | VWOUDHQXPUAQQZ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|