C19H25FN4O — CID 120735677
(1-tert-butyl-5-methylpyrazol-4-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 120735677) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is (1-tert-butyl-5-methylpyrazol-4-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (1-tert-butyl-5-methylpyrazol-4-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120735677 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (1-tert-butyl-5-methylpyrazol-4-yl)-[2-(3-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCNCC2c2cccc(F)c2)cnn1C(C)(C)C |
| InChI | InChI=1S/C19H25FN4O/c1-13-16(11-22-24(13)19(2,3)4)18(25)23-9-8-21-12-17(23)14-6-5-7-15(20)10-14/h5-7,10-11,17,21H,8-9,12H2,1-4H3 |
| InChIKey | MBTBRMUJNOKIKG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |