C20H23ClF2N2O — CID 120736221
3-(2-fluorophenyl)-1-[2-(3-fluorophenyl)piperazin-1-yl]butan-1-one;hydrochloride (PubChem CID 120736221) has the molecular formula C20H23ClF2N2O and a molecular weight of 380.87 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[2-(3-fluorophenyl)piperazin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 3-(2-fluorophenyl)-1-[2-(3-fluorophenyl)piperazin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120736221 |
| Molecular Formula | C20H23ClF2N2O |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[2-(3-fluorophenyl)piperazin-1-yl]butan-1-one;hydrochloride |
| SMILES | CC(CC(=O)N1CCNCC1c1cccc(F)c1)c1ccccc1F.Cl |
| InChI | InChI=1S/C20H22F2N2O.ClH/c1-14(17-7-2-3-8-18(17)22)11-20(25)24-10-9-23-13-19(24)15-5-4-6-16(21)12-15;/h2-8,12,14,19,23H,9-11,13H2,1H3;1H |
| InChIKey | GZPZQWOTLCLOBZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |