C20H20F4N2O — CID 120736228
4,4,4-trifluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]-3-phenylbutan-1-one (PubChem CID 120736228) has the molecular formula C20H20F4N2O and a molecular weight of 380.39 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]-3-phenylbutan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 120736228 |
| Molecular Formula | C20H20F4N2O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4,4,4-trifluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]-3-phenylbutan-1-one |
| SMILES | O=C(CC(c1ccccc1)C(F)(F)F)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C20H20F4N2O/c21-16-8-4-7-15(11-16)18-13-25-9-10-26(18)19(27)12-17(20(22,23)24)14-5-2-1-3-6-14/h1-8,11,17-18,25H,9-10,12-13H2 |
| InChIKey | LRPSTKIPPGPFIR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |