C13H13F5N2O — CID 120736628
2,2,3,3-tetrafluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 120736628) has the molecular formula C13H13F5N2O and a molecular weight of 308.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 120736628 |
| Molecular Formula | C13H13F5N2O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-[2-(3-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(N1CCNCC1c1cccc(F)c1)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H13F5N2O/c14-9-3-1-2-8(6-9)10-7-19-4-5-20(10)12(21)13(17,18)11(15)16/h1-3,6,10-11,19H,4-5,7H2 |
| InChIKey | VIPVAXDCKHVDNP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|