C23H30Cl2FN3O2 — CID 120736799
2-(4-benzylmorpholin-2-yl)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 120736799) has the molecular formula C23H30Cl2FN3O2 and a molecular weight of 470.42 g/mol. Its IUPAC name is 2-(4-benzylmorpholin-2-yl)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-benzylmorpholin-2-yl)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120736799 |
| Molecular Formula | C23H30Cl2FN3O2 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-(4-benzylmorpholin-2-yl)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CN(Cc2ccccc2)CCO1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C23H28FN3O2.2ClH/c24-20-8-4-7-19(13-20)22-15-25-9-10-27(22)23(28)14-21-17-26(11-12-29-21)16-18-5-2-1-3-6-18;;/h1-8,13,21-22,25H,9-12,14-17H2;2*1H |
| InChIKey | JTJAMPXDDRIWSB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |