C25H22N2O4 — CID 1207374
[3-[[(3S)-5-oxo-1-phenylpyrrolidine-3-carbonyl]amino]phenyl] 4-methylbenzoate (PubChem CID 1207374) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is [3-[[(3S)-5-oxo-1-phenylpyrrolidine-3-carbonyl]amino]phenyl] 4-methylbenzoate.
| Compound Name | [3-[[(3S)-5-oxo-1-phenylpyrrolidine-3-carbonyl]amino]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 1207374 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [3-[[(3S)-5-oxo-1-phenylpyrrolidine-3-carbonyl]amino]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cccc(NC(=O)[C@H]3CC(=O)N(c4ccccc4)C3)c2)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-17-10-12-18(13-11-17)25(30)31-22-9-5-6-20(15-22)26-24(29)19-14-23(28)27(16-19)21-7-3-2-4-8-21/h2-13,15,19H,14,16H2,1H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | FJMNPNKHTJRZAB-IBGZPJMESA-N |
| XLogP | 4.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|