C20H23FN4O3 — CID 120737468
2-[2-[2-(3-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 120737468) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[2-[2-(3-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[2-[2-(3-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 120737468 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[2-[2-(3-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(COCC(=O)N1CCNCC1c1cccc(F)c1)NCc1cccnc1 |
| InChI | InChI=1S/C20H23FN4O3/c21-17-5-1-4-16(9-17)18-12-23-7-8-25(18)20(27)14-28-13-19(26)24-11-15-3-2-6-22-10-15/h1-6,9-10,18,23H,7-8,11-14H2,(H,24,26) |
| InChIKey | FBYPVEOMHNUXRV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |