C18H20ClFN2O2S — CID 120737545
1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(4-hydroxyphenyl)sulfanylethanone;hydrochloride (PubChem CID 120737545) has the molecular formula C18H20ClFN2O2S and a molecular weight of 382.89 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(4-hydroxyphenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(4-hydroxyphenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 120737545 |
| Molecular Formula | C18H20ClFN2O2S |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(4-hydroxyphenyl)sulfanylethanone;hydrochloride |
| SMILES | Cl.O=C(CSc1ccc(O)cc1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C18H19FN2O2S.ClH/c19-14-3-1-2-13(10-14)17-11-20-8-9-21(17)18(23)12-24-16-6-4-15(22)5-7-16;/h1-7,10,17,20,22H,8-9,11-12H2;1H |
| InChIKey | SILKCBSXIMTVHD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |