C17H17ClN4O4 — CID 120738455
1-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one (PubChem CID 120738455) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is 1-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one.
| Compound Name | 1-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 120738455 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-[2-[2-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5-nitropyridin-2-one |
| SMILES | O=C(Cn1cc([N+](=O)[O-])ccc1=O)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C17H17ClN4O4/c18-14-4-2-1-3-13(14)15-9-19-7-8-21(15)17(24)11-20-10-12(22(25)26)5-6-16(20)23/h1-6,10,15,19H,7-9,11H2 |
| InChIKey | GHMLANVJPLRNEW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|