C18H18Cl3N3O3 — CID 120738607
2-(2-chloro-4-nitrophenyl)-1-[2-(2-chlorophenyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 120738607) has the molecular formula C18H18Cl3N3O3 and a molecular weight of 430.72 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenyl)-1-[2-(2-chlorophenyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(2-chloro-4-nitrophenyl)-1-[2-(2-chlorophenyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120738607 |
| Molecular Formula | C18H18Cl3N3O3 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-(2-chloro-4-nitrophenyl)-1-[2-(2-chlorophenyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1ccc([N+](=O)[O-])cc1Cl)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O3.ClH/c19-15-4-2-1-3-14(15)17-11-21-7-8-22(17)18(24)9-12-5-6-13(23(25)26)10-16(12)20;/h1-6,10,17,21H,7-9,11H2;1H |
| InChIKey | UHNIBZXNXCUBFT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|