C15H19Cl3N4O — CID 120738581
1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(1H-pyrazol-5-yl)ethanone;dihydrochloride (PubChem CID 120738581) has the molecular formula C15H19Cl3N4O and a molecular weight of 377.70 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(1H-pyrazol-5-yl)ethanone;dihydrochloride.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(1H-pyrazol-5-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120738581 |
| Molecular Formula | C15H19Cl3N4O |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-(1H-pyrazol-5-yl)ethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cc1ccn[nH]1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN4O.2ClH/c16-13-4-2-1-3-12(13)14-10-17-7-8-20(14)15(21)9-11-5-6-18-19-11;;/h1-6,14,17H,7-10H2,(H,18,19);2*1H |
| InChIKey | WNHNVTNYOBODOE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |