C17H19Cl2N3OS — CID 120739005
1-[2-(2-chlorophenyl)piperazin-1-yl]-2-pyridin-4-ylsulfanylethanone;hydrochloride (PubChem CID 120739005) has the molecular formula C17H19Cl2N3OS and a molecular weight of 384.33 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-pyridin-4-ylsulfanylethanone;hydrochloride.
| Compound Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-pyridin-4-ylsulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 120739005 |
| Molecular Formula | C17H19Cl2N3OS |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-[2-(2-chlorophenyl)piperazin-1-yl]-2-pyridin-4-ylsulfanylethanone;hydrochloride |
| SMILES | Cl.O=C(CSc1ccncc1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3OS.ClH/c18-15-4-2-1-3-14(15)16-11-20-9-10-21(16)17(22)12-23-13-5-7-19-8-6-13;/h1-8,16,20H,9-12H2;1H |
| InChIKey | OSISAUFLIOUZSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |