C16H20ClN3O2 — CID 120739774
4-[2-(2-chlorophenyl)piperazine-1-carbonyl]piperidin-2-one (PubChem CID 120739774) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)piperazine-1-carbonyl]piperidin-2-one.
| Compound Name | 4-[2-(2-chlorophenyl)piperazine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 120739774 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[2-(2-chlorophenyl)piperazine-1-carbonyl]piperidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCNCC2c2ccccc2Cl)CCN1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-13-4-2-1-3-12(13)14-10-18-7-8-20(14)16(22)11-5-6-19-15(21)9-11/h1-4,11,14,18H,5-10H2,(H,19,21) |
| InChIKey | LDGNASPSQFKUTD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |