C13H14Cl2N4OS — CID 120738665
[2-(2-chlorophenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone;hydrochloride (PubChem CID 120738665) has the molecular formula C13H14Cl2N4OS and a molecular weight of 345.26 g/mol. Its IUPAC name is [2-(2-chlorophenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone;hydrochloride.
| Compound Name | [2-(2-chlorophenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120738665 |
| Molecular Formula | C13H14Cl2N4OS |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [2-(2-chlorophenyl)piperazin-1-yl]-(thiadiazol-5-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cnns1)N1CCNCC1c1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN4OS.ClH/c14-10-4-2-1-3-9(10)11-7-15-5-6-18(11)13(19)12-8-16-17-20-12;/h1-4,8,11,15H,5-7H2;1H |
| InChIKey | UYIJFDJRBGHZQY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |