C16H18Cl2N2O2S — CID 120739287
[2-(2-chlorophenyl)piperazin-1-yl]-(4-methoxythiophen-2-yl)methanone;hydrochloride (PubChem CID 120739287) has the molecular formula C16H18Cl2N2O2S and a molecular weight of 373.31 g/mol. Its IUPAC name is [2-(2-chlorophenyl)piperazin-1-yl]-(4-methoxythiophen-2-yl)methanone;hydrochloride.
| Compound Name | [2-(2-chlorophenyl)piperazin-1-yl]-(4-methoxythiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120739287 |
| Molecular Formula | C16H18Cl2N2O2S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | [2-(2-chlorophenyl)piperazin-1-yl]-(4-methoxythiophen-2-yl)methanone;hydrochloride |
| SMILES | COc1csc(C(=O)N2CCNCC2c2ccccc2Cl)c1.Cl |
| InChI | InChI=1S/C16H17ClN2O2S.ClH/c1-21-11-8-15(22-10-11)16(20)19-7-6-18-9-14(19)12-4-2-3-5-13(12)17;/h2-5,8,10,14,18H,6-7,9H2,1H3;1H |
| InChIKey | QAEUCEPBFMYIGY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |