C18H22N4O3 — CID 120740298
1-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 120740298) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 120740298 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[2-[2-(4-ethylphenyl)piperazin-1-yl]-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | CCc1ccc(C2CNCCN2C(=O)Cn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H22N4O3/c1-2-13-3-5-14(6-4-13)15-11-19-8-10-22(15)17(24)12-21-9-7-16(23)20-18(21)25/h3-7,9,15,19H,2,8,10-12H2,1H3,(H,20,23,25) |
| InChIKey | JVSWZBUOAAZMKV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |