C22H28ClN3O2 — CID 120740327
N-[1-[2-(4-ethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]benzamide;hydrochloride (PubChem CID 120740327) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[1-[2-(4-ethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]benzamide;hydrochloride.
| Compound Name | N-[1-[2-(4-ethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120740327 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[1-[2-(4-ethylphenyl)piperazin-1-yl]-1-oxopropan-2-yl]benzamide;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)C(C)NC(=O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C22H27N3O2.ClH/c1-3-17-9-11-18(12-10-17)20-15-23-13-14-25(20)22(27)16(2)24-21(26)19-7-5-4-6-8-19;/h4-12,16,20,23H,3,13-15H2,1-2H3,(H,24,26);1H |
| InChIKey | OYXGTMBJPGBROC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |