C21H25Cl2N5O — CID 120740576
[2-(4-ethylphenyl)piperazin-1-yl]-(1-pyridin-3-ylpyrazol-4-yl)methanone;dihydrochloride (PubChem CID 120740576) has the molecular formula C21H25Cl2N5O and a molecular weight of 434.37 g/mol. Its IUPAC name is [2-(4-ethylphenyl)piperazin-1-yl]-(1-pyridin-3-ylpyrazol-4-yl)methanone;dihydrochloride.
| Compound Name | [2-(4-ethylphenyl)piperazin-1-yl]-(1-pyridin-3-ylpyrazol-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120740576 |
| Molecular Formula | C21H25Cl2N5O |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [2-(4-ethylphenyl)piperazin-1-yl]-(1-pyridin-3-ylpyrazol-4-yl)methanone;dihydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)c2cnn(-c3cccnc3)c2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H23N5O.2ClH/c1-2-16-5-7-17(8-6-16)20-14-23-10-11-25(20)21(27)18-12-24-26(15-18)19-4-3-9-22-13-19;;/h3-9,12-13,15,20,23H,2,10-11,14H2,1H3;2*1H |
| InChIKey | VOVXXUARQZJTRO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |