C22H34ClN3O2 — CID 120740910
1-[3-[2-(4-ethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]butan-1-one;hydrochloride (PubChem CID 120740910) has the molecular formula C22H34ClN3O2 and a molecular weight of 407.99 g/mol. Its IUPAC name is 1-[3-[2-(4-ethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 1-[3-[2-(4-ethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120740910 |
| Molecular Formula | C22H34ClN3O2 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 1-[3-[2-(4-ethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]butan-1-one;hydrochloride |
| SMILES | CCCC(=O)N1CCCC(C(=O)N2CCNCC2c2ccc(CC)cc2)C1.Cl |
| InChI | InChI=1S/C22H33N3O2.ClH/c1-3-6-21(26)24-13-5-7-19(16-24)22(27)25-14-12-23-15-20(25)18-10-8-17(4-2)9-11-18;/h8-11,19-20,23H,3-7,12-16H2,1-2H3;1H |
| InChIKey | HKYXFLHPADHQEW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |