C19H23ClN2O2S — CID 120741106
1-[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophen-3-yl]ethanone;hydrochloride (PubChem CID 120741106) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is 1-[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophen-3-yl]ethanone;hydrochloride.
| Compound Name | 1-[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophen-3-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120741106 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophen-3-yl]ethanone;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)c2cc(C(C)=O)cs2)cc1.Cl |
| InChI | InChI=1S/C19H22N2O2S.ClH/c1-3-14-4-6-15(7-5-14)17-11-20-8-9-21(17)19(23)18-10-16(12-24-18)13(2)22;/h4-7,10,12,17,20H,3,8-9,11H2,1-2H3;1H |
| InChIKey | HSEHGMYLUNBVCL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |