C18H22ClN3O2S — CID 120740428
5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophene-3-carboxamide;hydrochloride (PubChem CID 120740428) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophene-3-carboxamide;hydrochloride.
| Compound Name | 5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120740428 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5-[2-(4-ethylphenyl)piperazine-1-carbonyl]thiophene-3-carboxamide;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2C(=O)c2cc(C(N)=O)cs2)cc1.Cl |
| InChI | InChI=1S/C18H21N3O2S.ClH/c1-2-12-3-5-13(6-4-12)15-10-20-7-8-21(15)18(23)16-9-14(11-24-16)17(19)22;/h3-6,9,11,15,20H,2,7-8,10H2,1H3,(H2,19,22);1H |
| InChIKey | LSKJXFIVUXGPQI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |