C20H26ClN3O — CID 120758148
4-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]benzamide;hydrochloride (PubChem CID 120758148) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 4-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]benzamide;hydrochloride.
| Compound Name | 4-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120758148 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]benzamide;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2Cc2ccc(C(N)=O)cc2)cc1.Cl |
| InChI | InChI=1S/C20H25N3O.ClH/c1-2-15-3-7-17(8-4-15)19-13-22-11-12-23(19)14-16-5-9-18(10-6-16)20(21)24;/h3-10,19,22H,2,11-14H2,1H3,(H2,21,24);1H |
| InChIKey | NUVBXBVXXDCBEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |