C19H29ClN4 — CID 120769087
2-(4-ethylphenyl)-1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperazine;hydrochloride (PubChem CID 120769087) has the molecular formula C19H29ClN4 and a molecular weight of 348.92 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperazine;hydrochloride.
| Compound Name | 2-(4-ethylphenyl)-1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120769087 |
| Molecular Formula | C19H29ClN4 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-(4-ethylphenyl)-1-[(1-propan-2-ylpyrazol-4-yl)methyl]piperazine;hydrochloride |
| SMILES | CCc1ccc(C2CNCCN2Cc2cnn(C(C)C)c2)cc1.Cl |
| InChI | InChI=1S/C19H28N4.ClH/c1-4-16-5-7-18(8-6-16)19-12-20-9-10-22(19)13-17-11-21-23(14-17)15(2)3;/h5-8,11,14-15,19-20H,4,9-10,12-13H2,1-3H3;1H |
| InChIKey | OBHPZCLJBMDHJD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |