C17H26ClN5 — CID 120910252
1-[(1-tert-butylpyrazol-4-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride (PubChem CID 120910252) has the molecular formula C17H26ClN5 and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride.
| Compound Name | 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120910252 |
| Molecular Formula | C17H26ClN5 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-pyridin-4-ylpiperazine;hydrochloride |
| SMILES | CC(C)(C)n1cc(CN2CCNCC2c2ccncc2)cn1.Cl |
| InChI | InChI=1S/C17H25N5.ClH/c1-17(2,3)22-13-14(10-20-22)12-21-9-8-19-11-16(21)15-4-6-18-7-5-15;/h4-7,10,13,16,19H,8-9,11-12H2,1-3H3;1H |
| InChIKey | NAODUQXFKCQVPU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |