C19H29ClN4O — CID 120767459
1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride (PubChem CID 120767459) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride.
| Compound Name | 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120767459 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1Cc1cnn(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C19H28N4O.ClH/c1-19(2,3)23-14-15(11-21-23)13-22-10-9-20-12-17(22)16-7-5-6-8-18(16)24-4;/h5-8,11,14,17,20H,9-10,12-13H2,1-4H3;1H |
| InChIKey | QNTZLPNUWBSFSI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |