C19H20FN5 — CID 120910502
1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyridin-4-ylpiperazine (PubChem CID 120910502) has the molecular formula C19H20FN5 and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyridin-4-ylpiperazine.
| Compound Name | 1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyridin-4-ylpiperazine |
|---|---|
| PubChem CID | 120910502 |
| Molecular Formula | C19H20FN5 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-2-pyridin-4-ylpiperazine |
| SMILES | Fc1ccc(-n2cc(CN3CCNCC3c3ccncc3)cn2)cc1 |
| InChI | InChI=1S/C19H20FN5/c20-17-1-3-18(4-2-17)25-14-15(11-23-25)13-24-10-9-22-12-19(24)16-5-7-21-8-6-16/h1-8,11,14,19,22H,9-10,12-13H2 |
| InChIKey | KAIPLZVSEROXJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |