C19H21N5 — CID 120755227
1-[(1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine (PubChem CID 120755227) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[(1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[(1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120755227 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[(1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine |
| SMILES | c1ccc(-n2cc(CN3CCNCC3c3cccnc3)cn2)cc1 |
| InChI | InChI=1S/C19H21N5/c1-2-6-18(7-3-1)24-15-16(11-22-24)14-23-10-9-21-13-19(23)17-5-4-8-20-12-17/h1-8,11-12,15,19,21H,9-10,13-14H2 |
| InChIKey | KCGHOMMQPLCRRZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |