C20H24ClN5 — CID 120767925
1-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120767925) has the molecular formula C20H24ClN5 and a molecular weight of 369.90 g/mol. Its IUPAC name is 1-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120767925 |
| Molecular Formula | C20H24ClN5 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(3-methyl-1-phenylpyrazol-4-yl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | Cc1nn(-c2ccccc2)cc1CN1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C20H23N5.ClH/c1-16-18(15-25(23-16)19-7-3-2-4-8-19)14-24-11-10-22-13-20(24)17-6-5-9-21-12-17;/h2-9,12,15,20,22H,10-11,13-14H2,1H3;1H |
| InChIKey | VQSKQNVMNVBNTH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |