C16H26N6 — CID 120911966
1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine (PubChem CID 120911966) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine.
| Compound Name | 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 120911966 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-[(1-tert-butylpyrazol-4-yl)methyl]-2-(1-methylimidazol-2-yl)piperazine |
| SMILES | Cn1ccnc1C1CNCCN1Cc1cnn(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H26N6/c1-16(2,3)22-12-13(9-19-22)11-21-8-5-17-10-14(21)15-18-6-7-20(15)4/h6-7,9,12,14,17H,5,8,10-11H2,1-4H3 |
| InChIKey | HNXJXVSCWFZITO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |